loading
back to top

Hidrocacbon

Chia sẻ: camvan.hoa.hnue@gmail.com | Ngày: 2018-12-05 23:33:28 | Trạng thái: Được duyệt

Chủ đề: Hoá 11    hidrocacbon    hữu cơ   

41
Lượt xem
0
Tải về





Bên trên chỉ là 1 phần trích dẫn trong tài liệu để xem hết tài liệu vui lòng tải về máy. Hidrocacbon

Hidrocacbon

Hidrocacbon




Tóm tắt nội dung
Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang Câu 1: Đốt cháy một hiđrocacbon bằng lượng O2 dư được hỗn hợp khí Z. Muốn tách lấy O2 dư ra khỏi thì dẫn hỗn hợp khí qua bình chứa A. Photpho (P). B. P2O5. C. Dung dịch kiềm. D. Dung dịch H2SO4 đặc. Câu 2: Công thức đơn giản nhất của hiđrocacbon là CnH2n+1. thuộc dãy đồng đẳng nào A. Ankan. B. Xicloankan. C. hoặc B. D. không đủ dữ kiện để xác định. Câu 3: Phần trăm khối lượng cacbon trong phân tử ankan bằng 83,33%. Công thức phân tử của là A. C2H6. B. C3H8. C. C4H10. D. C5H12. Câu 4: Isohexan tác dụng với clo (có chiếu sáng) có thể tạo tối đa bao nhiêu dẫn xuất monoclo A. 3. B. 4. C. 5. D. 6. Câu 5: Khi brom hóa ankan chỉ được một dẫn xuất monobrom duy nhất có tỉ khối hơi so với hiđro là 75,5. có tên là A. 3,3-đimetylhexan. B. isopentan. C. 2,2-đimetylpropan. D. 2,2,3,3- tetraetylbutan. Câu 6:...
Nội dung tài liệu
Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang Câu 1: Đốt cháy một hiđrocacbon bằng lượng O2 dư được hỗn hợp khí Z. Muốn tách lấy O2 dư ra khỏi thì dẫn hỗn hợp khí qua bình chứa A. Photpho (P). B. P2O5. C. Dung dịch kiềm. D. Dung dịch H2SO4 đặc. Câu 2: Công thức đơn giản nhất của hiđrocacbon là CnH2n+1. thuộc dãy đồng đẳng nào A. Ankan. B. Xicloankan. C. hoặc B. D. không đủ dữ kiện để xác định. Câu 3: Phần trăm khối lượng cacbon trong phân tử ankan bằng 83,33%. Công thức phân tử của là A. C2H6. B. C3H8. C. C4H10. D. C5H12. Câu 4: Isohexan tác dụng với clo (có chiếu sáng) có thể tạo tối đa bao nhiêu dẫn xuất monoclo A. 3. B. 4. C. 5. D. 6. Câu 5: Khi brom hóa ankan chỉ được một dẫn xuất monobrom duy nhất có tỉ khối hơi so với hiđro là 75,5. có tên là A. 3,3-đimetylhexan. B. isopentan. C. 2,2-đimetylpropan. D. 2,2,3,3- tetraetylbutan. Câu 6: Hiđrocacbon mạch hở trong phân tử chỉ chứa liên kết và có hai nguyên tử cacbon bậc ba trong một phân tử. Đốt cháy hoàn toàn thể tích sinh ra thể tích CO2 (ở cùng điều kiện nhiệt độ, áp suất). Khi cho tác dụng với Cl2 (theo tỉ lệ số mol 1), số dẫn xuất monoclo tối đa sinh ra là A. 3. B. 4. C. 2. D. 5. Câu 7: Có bao nhiêu ankan là chất khí điều kiện thường khi phản ứng với clo (có ánh sáng, tỉ lệ mol 1:1) tạo ra dẫn xuất monoclo A. 4. B. 2. C. 5. D. 3. Câu 8: Có bao nhiêu ankan là chất khí điều kiện thường khi phản ứng với clo (có ánh sáng, tỉ lệ mol 1:1) tạo ra dẫn xuất monoclo A. 4. B. 2. C. 5. D. 3. HIĐROCACBONTrịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang Câu 9: Khi clo hóa metan thu được một sản phẩm thế chứa 89,12% clo về khối lượng. Công thức của sản phẩm là A. CH3Cl. B. CH2Cl2. C. CHCl3. D. CCl4. Câu 10: Ankan nào sau đây chỉ cho sản phẩm thế duy nhất khi tác dụng với Cl2 (as) theo tỉ lệ mol (1 1) CH3CH2CH3 (a), CH4 (b), CH3C(CH3)2CH3 (c), CH3CH3 (d), CH3CH(CH3)CH3 (e) A. (a), (e), (d). B. (b), (c), (d). C. (c), (d), (e). D. (a), (b), (c), (e), (d). Câu 11: Đốt cháy các hiđrocacbon của dãy đồng đẳng nào dưới đây thì tỉ lệ mol H2O mol CO2 giảm khi số cacbon tăng A. ankan. B. anken. C. Ankin. D. Aren. Câu 12: Khi đốt cháy ankan thu được H2O và CO2 với tỷ lệ tương ứng biến đổi như thế nào A. Tăng từ đến +∞. B. Giảm từ đến 1. C. Tăng từ đến. D. Giảm từ đến 0. Câu 13: Trong phòng thí nghiệm có thể điều chế metan bằng cách nào sau đây A. Nhiệt phân natri axetat với vôi tôi xút. B. Crăckinh butan. C. Từ phản ứng của nhôm cacbua với nước. D. A, C. Câu 14: Dẫn hỗn hợp khí gồm propan và xiclopropan vào dung dịch brom sẽ quan sát thấy hiện tượng nào sau đây A. Màu của dung dịch nhạt dần, có khí thoát ra. B. Màu của dung dịch nhạt dần, không có khí thoát ra. C. Màu của dung dịch không đổi. D. Màu của dung dịch mất hẳn, không có khí thoát ra. Câu 15: Cho phản ứng Br2 BrCH2CH2CH2Br. là A. propan. B. 1-brompropan. C. xiclopopan. D. và đúng. Câu 16: Hai xicloankan M, đều có tỉ khối hơi so với metan bằng 5,25. Khi monoclo hóa có chiếu sáng thì chỉ cho hợp chất hữu cơ duy nhất, cho hợp chất hữu cơ. Tên của M, là A. Metylxiclobuten và xiclopentan. B. Xiclopentan và xiclobuten. C. Kết quả khác. D. Xiclohecxan, metylxiclopentan hoặc isopropylxiclopropan. Câu 17: Anken có đặc điểm Trong phân tử có liên kết xích ma (σ ). CTPT của là A. C2H4. B. C4H8. C. C3H6. D. C5H10. Câu 18: Số đồng phân của C4H8 (kể cả mạch vòng, đồng phân cis-trans nếu có) là A. 7. B. 4. C. 6. D. 5. Câu 19: Hợp chất C5H10 có bao nhiêu đồng phân anken A. 4. B. 5. C. 6. D. 7. Câu 20: Hợp chất C5H10 có bao nhiêu đồng phân cấu tạo ?Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang A. 4. B. 5. C. 6. D. 10. Câu 21: Cho các chất sau CH2=CHCH2CH2CH=CH2 CH2=CHCH=CHCH2CH3 CH3C(CH3)=CHCH2 CH2=CHCH2CH=CH2 CH3CH2CH=CHCH2CH3 CH3C(CH3)=CHCH2CH3 CH3CH2C(CH3)=C(C2H5)CH(CH3)2 CH3CH=CHCH3. Số chất có đồng phân hình học là A. 4. B. 1. C. 2. D. 3. Câu 22: Trong các hiđrocacbon sau propen, but-1-en, but-2-en, penta-1,4-đien, penta-1,3-đien. Những hiđrocacbon có đồng phân cis-trans là A. propen, but-1-en. B. propen, but-2-en. B. pent-1-en, but-1-en. D. but-2-en, penta-1,3-đien. Câu 23: Cho các chất xiclobutan, 2-metylpropen, but-1-en, cis-but-2-en, 2-metylbut-2-en. Dãy gồm các chất sau khi phản ứng với H2 (dư, xúc tác Ni, to), cho cùng một sản phẩm là A. xiclobutan, cis-but-2-en và but-1-en. B. but-1-en, 2-metylpropen và cis-but-2-en. C. xiclobutan, 2-metylbut-2-en và but-1-en. D. 2-metylpropen, cis -but-2-en và xiclobutan. Câu 24: Hiđrat hóa anken chỉ tạo thành ancol (rượu). Hai anken đó là A. 2-metylpropen và but-1-en (hoặc buten-1). B. propen và but-2-en (hoặc buten-2). C. eten và but-2-en (hoặc buten-2). D. eten và but-1-en (hoặc buten-1). Câu 25: Hiđrat hóa hỗn hợp gồm anken thu được chỉ thu được ancol. gồm A. CH2=CH2 và CH2=CHCH3. B. CH2=CH2 và CH3CH=CHCH3. C. hoặc D. D. CH3CH=CHCH3 và CH2=CHCH2CH3. Câu 26: Số cặp anken thể khí điều kiện thường (chỉ tính đồng phân cấu tạo) thỏa mãn điều kiện Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là A. 6. B. 3. C. 5. D. 4. Câu 27: Số cặp anken thể khí điều kiện thường thỏa mãn điều kiện Khi hiđrat hoá tạo thành hỗn hợp gồm ba ancol là A. 6. B. 7. C. 5. D. 8. Câu 28: Số anken thể khí (đktc) thoả mãn điều kiện Khi hiđrat hoá tạo thành ancol duy nhất là A. 2. B. 3. C. 4. D. 5. Câu 29: Hợp chất 2-metylbut-2-en là sản phẩm chính của phản ứng tách từ chất nào trong các chất sau A. 2-brom-2-metylbutan. B. 2-metylbutan -2- ol. C. 3-metylbutan-2- ol. D. Tất cả đều đúng. Câu 0: Khi tách nước từ rượu (ancol) 3-metylbutanol-1 (hay 3-metylbutan-1-ol), sản phẩmTrịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang chính thu được là A. 2-metylbuten-3 (hay 2-metylbut-3-en). B. 3-metylbuten-2 (hay 3-metylbut-2-en). C. 3-metylbuten-1 (hay 3-metylbut-1-en). D. 2-metylbuten-2 (hay 2-metylbut-2-en). Câu 31: Cho các chất xiclobutan, 2-metylpropen, but-1-en, trans-but-2-en, 2-metylbut-2-en. Dãy gồm các chất sau khi phản ứng với H2 (dư, xúc tác Ni, to), cho cùng một sản phẩm là A. xiclobutan, trans-but-2-en và but-1-en. B. but-1-en, 2-metylpropen và cis-but-2-en. C. xiclobutan, 2-metylbut-2-en và but-1-en. D. 2-metylpropen, cis -but-2-en và xiclobutan. Câu 32: Hai chất X, có CTPT C3H6 và C4H8 và đều tác dụng được với nước brom. X, là A. Hai anken hoặc xicloankan vòng cạnh. C. Hai anken hoặc xicloankan vòng cạnh. B. Hai anken hoặc hai ankan. D. Hai anken đồng đẳng của nhau. Câu 33: Trùng hợp eten, sản phẩm thu được có cấu tạo là A. (-CH2=CH2-)n B. (-CH2-CH2-)n. C. (-CH=CH-)n D. (-CH3-CH3-)n Câu 34: Một hiđrocacbon đốt cháy cho ra số mol H2O bằng số mol CO2. Vậy có thể là 1. anken. 2. xicloankan 3. ankadien. 4. ankin. A. chỉ có 1. B. chỉ có 4. C. chỉ có 1,3. D. chỉ có 1, 2. Câu 35: Oxi hoá etilen bằng dung dịch KMnO4 thu được sản phẩm là A. MnO2, C2H4(OH)2, KOH. C. K2CO3, H2O, MnO2. B. C2H5OH, MnO2, KOH. D. C2H4(OH)2, K2CO3, MnO2. Câu 36: Khi điều chế C2H4 từ C2H5OH và H2SO4 đặc 170oC thì C2H4 bị lẫn tạp chất CO2 và SO2. Có thể tinh chế C2H4 bằng A. dd KMnO4. B. dd brom. C. dd KOH. D. dd NaCl. Câu 37: Số đồng phân cấu tạo thuộc loại ankađien ứng với công thức phân tử C5H8 là A. 4. B. 5. C. 6. D. 7. Câu 38: Số đồng phân thuộc loại ankađien ứng với công thức phân tử C5H8 là A. 4. B. 5. C. 6. D. 7. Câu 39: C5H8 có bao nhiêu đồng phân ankađien liên hợp ?Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang A. 2. B. 3. C. 4. D. 5. Câu 40: C5H8 có bao nhiêu đồng phân cấu tạo ankađien liên hợp A. 2. B. 3. C. 4. D. 5. Câu 41: Công thức phân tử của buta-1,3-đien (đivinyl) và isopren (2-metylbuta-1,3-đien) lần lượt là A. C4H6 và C5H10. B. C4H4 và C5H8. C. C4H6 và C5H8. D. C4H8 và C5H10. Câu 42: Hợp chất nào trong số các chất sau có liên kết xích ma và liên kết A. Buta-1,3-đien. B. Penta-1,3-đien. C. Stiren. D. Vinyl axetilen. Câu 43: Hợp chất nào trong số các chất sau có liên kết xích ma và liên kết A. Buta-1,3-đien. B. Tuloen. C. Stiren. D. Vinyl axetilen. Câu 44: Cho phản ứng giữa buta-1,3-đien và HBr -80oC (tỉ lệ mol 1:1), sản phẩm chính của phản ứng là A. CH3CHBrCH=CH2. B. CH2BrCH2CH=CH2. C. CH3CH=CBrCH3. D. CH3CH=CHCH2Br. Câu 45: Cho phản ứng giữa buta-1,3-đien và HBr 40oC (tỉ lệ mol 1:1), sản phẩm chính của phản ứng là A. CH3CHBrCH=CH2. B. CH2BrCH2CH=CH2. C. CH3CH=CBrCH3. D.CH3CH=CHCH2Br. Câu 46: Isopren tham gia phản ứng với dung dịch Br2 theo tỉ lệ mol 1:1 tạo ra tối đa bao nhiêu sản phẩm A. 4. B. 1. C. 3. D. 2. Câu 47: Isopren tham gia phản ứng với dung dịch HBr theo tỉ lệ mol 1:1 tạo ra tối đa bao nhiêu sản phẩm cộng A. 8. B. 5. C. 7. D. 6. Câu 48: Chất nào sau đây không phải là sản phẩm cộng giữa dung dịch brom và isopren (tỉ lệ mol 1:1) A. CH2Br -C(CH3)Br-CH=CH2. B. CH2BrC(CH3)=CHCH2Br. C. CH2Br- CH=CH-CH2-CH2Br. D. CH2=C(CH3)CHBrCH2Br. Câu 49: Trùng hợp đivinyl tạo ra cao su Buna có cấu tạo là A. (-C2H-CH-CH-CH2-)n. B. (-CH2-CH=CH-CH2-)n. C. (-CH2-CH-CH=CH2-)n. D. (-CH2-CH2-CH2-CH2-)n. Câu 50: Đồng trùng hợp đivinyl và stiren thu được cao su Buna-S có công thức cấu tạo làTrịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang A. (-CH2-CH=CH-CH2-CH(C6H5)-CH2-)n. B. (-C2H-CH-CH-CH2-CH(C6H5)-CH2-)n. C. (-CH2-CH-CH=CH2- CH(C6H5)-CH2-)n D. (-CH2-CH2-CH2-CH2- CH(C6H5)-CH2-)n. Câu 51: Đồng trùng hợp đivinyl và acrylonitrin thu được cao su Buna-N có công thức cấu tạo là A. (-C2H-CH-CH-CH2-CH(CN)-CH2-)n. B. (-CH2-CH2-CH2-CH2- CH(CN)-CH2-)n. C. (-CH2-CH-CH=CH2-CH(CN)-CH2-)n. D. (-CH2-CH=CH-CH2-CH(CN)-CH2-)n. Câu 52: Trùng hợp isopren tạo ra cao su isopren có cấu tạo là A. (-C2H-C(CH3)-CH-CH2-)n. C. (-CH2-C(CH3)-CH=CH2-)n. B. (-CH2-C(CH3)=CH-CH2-)n. D. (-CH2-CH(CH3)-CH2-CH2-)n. Câu 53: C4H6 có bao nhiêu đồng phân mạch hở A. 5. B. 2. C. 3. D. 4. Câu 54: Có bao nhiêu ankin ứng với công thức phân tử C5H8 A. 1. B. 2. C. 3. D. Câu 55: Ankin C4H6 có bao nhiêu đồng phân cho phản ứng với dung dịch chứa AgNO3/NH3 A.4. B. 2. C. 1. D. 3. Câu 56: Có bao nhiêu đồng phân ankin C5H8 tác dụng được với dung dịch AgNO3/NH3 tạo kết tủa A. 3. B. 2. C. 4. D. 1. Câu 57: Ankin C6H10 có bao nhiêu đồng phân phản ứng với dung dịch AgNO3/NH3 tạo kết tủa A. 3. B. 4. C. 5. D. 6. Câu 58: Trong phân tử ankin X, hiđro chiếm 11,111% khối lượng. Có bao nhiêu ankin phù hợp A. 1. B. 2. C. 3. D. Câu 59: Danh pháp quốc tế của ankin CH3CH(CH3)C≡CCH3 là A. 4-metylpent-2-in. B. 2-metylpent-3-in. C. 4-metylpent-3-in. D. 2-metylpent-4-in. Câu 60: Cho phản ứng C2H2 H2O A. là chất nào sau đây A. CH2 CHOH. B. CH3CHO. C. CH3COOH. D. C2H5OH. Câu 61: Cho sơ đồ phản ứng sau CH3C≡CH AgNO3/NH3 NH4NO3. có công thức cấu tạo là A. CH3CAg≡CAg. B. CH3-C≡CAg. C. AgCH2C≡CAg. D. A, B, đều đúng.Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang Câu 62: Trong số các hiđrocacbon mạch hở sau C4H10, C4H6, C4H8, C3H4, những hiđrocacbon nào có thể tạo kết tủa với dung dịch AgNO3/NH3 A. C4H10 ,C4H8 B. C4H6, C3H4 C. Chỉ có C4H6 D. Chỉ có C3H4. Câu 63: Hỗn hợp gồm hiđro và các hiđrocacbon no, chưa no. Cho vào bình có niken xúc tác, đun nóng bình một thời gian ta thu được hỗn hợp B. Phát biểu nào sau đây không đúng A. Đốt cháy hoàn toàn hỗn hợp cho số mol CO2 và số mol nước luôn bằng số mol CO2 và số mol nước khi đốt cháy hoàn toàn hỗn hợp B. B. Số mol oxi tiêu tốn để đốt hoàn toàn hỗn hợp luôn bằng số mol oxi tiêu tốn khi đốt hoàn toàn hỗn hợp B. C. Số mol Số mol Số mol H2 tham gia phản ứng. D. Khối lượng phân tử trung bình của hỗn hợp bằng khối lượng phân tử trung bình của hỗn hợp B. Câu 64: Để làm sạch etilen có lẫn axetilen ta cho hỗn hợp đi qua dung dịch nào sau đây A. dd brom dư. B. dd KMnO4 dư. C. dd AgNO3/NH3 dư. D. A, B, đều đúng. Câu 65: Chất nào sau đây không điều chế trực tiếp được axetilen A. Ag2C2. B. CH4. C. Al4C3. D. CaC2. Câu 66: Để nhận biết các bình riêng biệt đựng các khí không màu sau đây SO2, C2H2, NH3 ta có thể dùng hoá chất nào sau đây A. Dung dịch AgNO3/NH3. B. Dung dịch Ca(OH)2. C. Quì tím ẩm. D. Dung dịch NaOH. Câu 67: Hỗn hợp khí nào dưới đây không làm nhạt màu dung dịch brom A. CO2, SO2, N2, H2. B. CO2, H2, O2, CH4. C. H2S, N2, H2, CO2. D. CH4, C2H6, C3H6, C4H10. Câu 68: Câu nào sau đây sai A. Butin có đồng phân vị trí nhóm chức. B. Ankin có số đồng phân ít hơn anken tương ứng (Từ C4 trở đi). C. Hai ankin đầu dãy không có đồng phân. D. Ankin tương tự anken đều có đồng phân hình học. Câu 69: Chất hữu cơ có công thức phân tử C6H6 mạch thẳng. Biết mol tác dụng với AgNO3 dư trong NH3 tạo ra 292 gam kết tủa. CTCT của có thể là A. CH≡C-C≡C-CH2-CH3. C. CH≡C-CH2-CH=C=CH2. B. CH≡C-CH2-C≡C -CH3. D. CH≡C-CH2-CH2-C≡CH. Câu 70: là hỗn hợp gồm hiđrocacbon mạch hở, không cùng dãy đồng đẳng. Đốt cháy được nCO2 nH2O. có thể gồm A. 1ankan anken. B. 1ankan 1ankin. C. 1anken 1ankin. D. 1ankin 1ankađien.Trịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang -Câu 71: là hỗn hợp gồm ankan, anken và 1ankin với số mol tương ứng lần lượt là x, y, z. Đốt cháy hoàn toàn được sản phẩm có mol CO2 và mol nước bằng nhau. Biểu thức đúng là A. z. B. 2x. C. y. D. z. Câu 72: Trong các họ hiđrocacbon ankan, anken, ankađien, ankin, xicloankan, xicloanken, họ hiđrocacbon nào khi đốt cháy cho ra số mol nước nhỏ hơn số mol CO2 A. Ankađien, ankin. B. Ankin, xicloanken. C. Ankin, xicloankan. D. Ankin, ankađien, xicloanken. Câu 73: Vitamin công thức phân tử C20H30O, có chứa vòng cạnh và không có chứa liên kết ba. Số liên kết đôi trong phân tử vitamin là A. 7. B. 6. C. 5. D. 4. Câu 74: Licopen, công thức phân tử C40H56 là chất màu đỏ trong quả cà chua, chỉ chứa liên kết đôi và liên kết đơn trong phân tử. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. Vậy licopen có A. vòng 12 nối đôi. B. vòng nối đôi. C. vòng nối đôi. D. mạch hở 13 nối đôi. Câu 75: Metol C10H20O và menton C10H18O chúng đều có trong tinh dầu bạc hà. Biết phân tử metol không có nối đôi, còn phân tử menton có nối đôi. Vậy kết luận nào sau đây là đúng A. Metol và menton đều có cấu tạo vòng. B. Metol có cấu tạo vòng, menton có cấu tạo mạch hở. C. Metol và menton đều có cấu tạo mạch hở. D. Metol có cấu tạo mạch hở, menton có cấu tạo vòng. Câu 76: Có chuỗi phản ứng sau H2 B HCl (spc) Xác định N, B, D, biết rằng là một hiđrocacbon mạch hở, chỉ có đồng phân. A. C2H2 Pd C2H4 CH3CH2Cl. B. C4H6 Pd C4H8 CH2ClCH2 CH2CH3. C. C3H4 Pd C3H6 CH3CHClCH3. D. C3H4 Pd C3H6 CH3CH2CH2Cl. Câu 77: Trong các hiđrocacbon sau: C5H10, C6H12, C7H8, C9H10, hiđrocacbon nào là aren có nhánh không no Hiđrocacbon ấy có bao nhiêu đồng phân A. C6H12 đồng phân. B. C9H10 đồng phân. C. C9H10 đồng phân. D. C7H8 đồng phân. Câu 78: Một hợp chất hữu cơ có vòng benzen có CTĐGN là C3H2Br và 236. Gọi tên hợp chất này biết rằng hợp chất này là sản phẩm chính trong phản ứng giữa C6H6 và Br2 (xúc tác Fe) A. o-hoặc p-đibrombenzen. B. o-hoặc p-đibromuabenzen. C. m-đibromuabenzen. D. m-đibrombenzen. KOHTrịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang Câu 79: Một hiđrocacbon có CTPT là C9H10. Có bao nhiêu đồng phân biết có chứa vòng benzen A. 5. B. 4. C. 3. D. 7. Câu 80: Hai hiđrocacbon và đều có công thức phân tử C6H6 và có mạch cacbon không nhánh. làm mất màu dung dịch nước brom và dung dịch thuốc tím điều kiện thường. không tác dụng với dung dịch trên điều kiện thường nhưng tác dụng được với H2 dư tạo ra có công thức phân tử C6H12. tác dụng với dung dịch AgNO3/NH3 dư tạo ra C6H4Ag2. và là A. Hex-1,4-điin và benzen. B. Hex-1,4-điin và toluen. C. Benzen và Hex-1,5-điin. D. Hex-1,5-điin và benzen. Câu 81: Đốt cháy hoàn toàn hiđrocacbon cho CO2 và H2O theo tỉ lệ mol 1,75 về thể tích. Cho bay hơi hoàn toàn 5,06 gam thu được một thể tích hơi đúng bằng thể tích của 1,76 gam oxi trong cùng điều kiện. Nhận xét nào sau đây là đúng đối với A. không làm mất màu dung dịch Br2 nhưng làm mất màu dung dịch KMnO4 đun nóng. B. tác dụng với dung dịch Br2 tạo kết tủa trắng. C. có thể trùng hợp thành PS. D. tan tốt trong nước. Câu 82: Stiren là một hiđrocacbon còn có tên gọi là A. Toluen. B. Xilen. C. Vinyl bezen. D. Cumen. Câu 83: 1,3-đimetylbezen còn có tên là A. Stiren. B. m-xilen. C. m-crezol. D. Cumen. Câu 84: Cumen còn có tên gọi là A. isopropylbenzen. B. etylbenzen. C. sec-butylbezen. D. o-xilen. Câu 85: Chỉ dùng hóa chất nào dưới đây có thể phân biệt được lọ mất nhãn chứa benzen, toluen, stiren. A. Nước brom. B. dd KMnO4. C. Na. D. NaOH. Câu 86: Dãy gồm các chất đều có khả năng tham gia phản ứng trùng hợp là A. stiren clobenzen isopren but-1-en. B. 1,2-điclopropan vinylaxetilen vinylbenzen toluen. C. buta-1,3-đien cumen etilen trans-but-2-en. D. 1,1,2,2-tetrafloeten propilen stiren vinyl clorua. Câu 87: Cho các phản ứng HBr C2H5OH 0t C2H4 Br2 C2H4 HBr C2H6 Br2 askt (1:1 mol )  Số phản ứng tạo ra C2H5Br là A. 4. B. 3. C. 2. D. 1. Câu 88: Khi tiến hành phản ứng thế giữa ankan với khí clo có chiếu sáng người ta thu được hỗn hợp chỉ chứa hai chất sản phẩm. Tỉ khối hơi của so với hiđro là 35,75. Tên của làTrịnh xuân Đảm SĐT: 01678774916 https://www.facebook.com/trinhxuan.dam Trung Tâm Thầy Nguyễn Bá Tuấn Học off địa chỉ 3B2- Ngõ 09 Lê Đức Thọ Hà Nộ, Gần đại học Thương Mại Hà Nội Trang 10 A. 2,2-đimetylpropan. B. 2-metylbutan. C. pentan. D. 2-đimetylpropan. Câu 89: Cho 0,5 lít hỗn hợp gồm hyđrocacbon và khí cacbonic vào 2,5 lít oxi (lấy dư) rồi đốt. Thể tích của hỗn hợp thu được sau khi đốt là 3,4 lít. Cho hỗn hợp qua thiết bị làm lạnh, thể tích hỗn hợp khí còn lại 1,8 lít và cho lội qua dung dịch KOH chỉ còn 0,5 lít khí. Thể tích các khí được đo trong cùng điều kiện. Tên gọi của hiđrocacbon là A. propan. B. xiclobutan. C. propen. D. xiclopropan. Câu 90: Hiđrocacbon cháy cho thể tích hơi nước gấp 1,2 lần thể tích CO2 (đo cùng điều kiện to, p). Khi tác dụng với clo tạo dẫn xuất monoclo khác nhau. có tên là A. isopentan. B. propan. C. etan. D. 2,2-đimetylpropan. Câu 91: Khi crăckinh hoàn toàn một thể tích ankan thu được ba thể tích hỗn hợp (các thể tích khí đo cùng điều kiện nhiệt độ và áp suất) tỉ khối của so với H2 bằng 12. Công thức phân tử của là A. C6H14. B. C3H8. C. C4H10. D. C5H12. Câu 92: Khi crăckinh hoàn toàn một ankan thu được hỗn hợp (các thể tích khí đo cùng điều kiện nhiệt độ và áp suất) tỉ khối của so với H2 bằng 14,5. Công thức phân tử của là A. C6H14 B. C3H8. C. C4H10. D. C5H12. Câu 93: Crăckinh hoàn toàn 6,6 gam propan được hỗn hợp gồm hai hiđrocacbon. Dẫn toàn bộ qua bình đựng 400 ml dung dịch brom mol/l thấy khí thoát ra khỏi bình có tỉ khối so metan là 1,1875. Giá trị là A. 0,5M. B. 0,25M. C. 0,175M. D. 0,1M. Câu 94: Crăckinh 4,4 gam propan được hỗn hợp (gồm hiđrocacbon). Dẫn qua nước brom dư thấy khí thoát ra có tỉ khối so với H2 là 10,8. Hiệu suất crackinh là A. 90%. B. 80%. C. 75%. D. 60%. Câu 95: Crăking n-butan thu được 35 mol hỗn hợp gồm H2, CH4, C2H4, C2H6, C3H6, C4H8 và một phần butan chưa bị crăking. Giả sử chỉ có các phản ứng tạo ra các sản phẩm trên. Cho qua bình nước brom dư thấy còn lại 20 mol khí. Nếu đốt cháy hoàn toàn thì thu được mol CO2. Hiệu suất phản ứng tạo hỗn hợp và giá trị của là A. 75,00% 140. B. 75,00% 80. C. 42,86% 40. D. 25,00% 70. Câu 96: Crăking 40 lít n-butan thu được 56 lít hỗn hợp gồm H2, CH4, C2H4, C2H6, C3H6, C4H8 và một phần n-butan chưa bị crăking (các thể tích khí đo cùng điều kiện nhiệt độ và áp suất). Giả sử chỉ có các phản ứng tạo ra các sản phẩm trên. Hiệu suất phản ứng tạo hỗn hợp là A. 40%. B. 20%. C. 80%. D. 20%.

0 Bình luận



Bạn cần đăng nhập mới có thể viết bình luận

Có thể bạn quan tâm




Nhận thông tin qua email


Cập nhật tài liệu hay và mới tại doc24.vn qua email



Hỗ trợ trực tuyến