Cộng đồng chia sẻ tri thức Doc24.vn

Chủ đề 3: Đồng đẳng, đồng phân và danh pháp của ankan

Gửi bởi: Phạm Thọ Thái Dương vào ngày 2020-03-25 08:30:43

Mục lục
* * * * *

I. Phương pháp giải

- Nắm chắc kiến thức về đồng đẳng và đồng phân.

- Cách gọi tên của ankan:

Bước 1. Chọn mạch chính : là mạch dài nhất có nhiều nhóm thế nhất.

Bước 2. Đánh số vị trí cacbon trong mạch chính bắt đầu từ phía gần nhánh hơn.

Bước 3. Gọi tên : Vị trí mạch nhánh + tên nhánh + tên mạch chính

II. Ví dụ

Bài 1: Viết các đồng phân ankan của C4H10 , C5H12 . Gọi tên các đồng phân.

Trả lời

- Các đồng phân ankan của C4H10

CH3-CH2-CH2-CH3 n-butan ; CH3-CH(CH3)-CH3 2-metylpropan

-Các đồng phân của C5H12

CH3-CH2-CH2-CH2-CH3 n – pentan; CH3-CH(CH3)-CH2-CH3 2-metylbutan

CH3-C(CH3)2-CH3 2,2-đimetyl propan

Bài 2: Viết CTCT các chất có tên gọi sau :

a) 4-etyl-3,3-đimetylhexan

b) 1-brom-2-clo-3-metylpentan

c) 1,2-điclo-3-metylbutan

d) 2,2,3-trimetylpentan.

Trả lời

a. CH3-CH2-C(CH3)2-CH(C2H5)-CH2-CH3

b. CH2Br-CHCl-CH(CH3)-CH2-CH3

c. CH2Cl-CHCl-CH(CH3)-CH3

d. CH3-CH(CH3)2-CH2-CH2-CH3

Lượt xem: 156